C46H94N4 — CID 59645540
N'-[2-[(3-amino-2-methylpropyl)-[(Z)-octadec-9-enyl]amino]ethyl]-2-methyl-N'-[(Z)-octadec-9-enyl]propane-1,3-diamine (PubChem CID 59645540) has the molecular formula C46H94N4 and a molecular weight of 703.29 g/mol. Its IUPAC name is N'-[2-[(3-amino-2-methylpropyl)-[(Z)-octadec-9-enyl]amino]ethyl]-2-methyl-N'-[(Z)-octadec-9-enyl]propane-1,3-diamine.
| Compound Name | N'-[2-[(3-amino-2-methylpropyl)-[(Z)-octadec-9-enyl]amino]ethyl]-2-methyl-N'-[(Z)-octadec-9-enyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 59645540 |
| Molecular Formula | C46H94N4 |
| Molecular Weight | 703.29 g/mol |
| Exact Mass | 702.75 |
| IUPAC Name | N'-[2-[(3-amino-2-methylpropyl)-[(Z)-octadec-9-enyl]amino]ethyl]-2-methyl-N'-[(Z)-octadec-9-enyl]propane-1,3-diamine |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN(CCN(CCCCCCCC/C=C\CCCCCCCC)CC(C)CN)CC(C)CN |
| InChI | InChI=1S/C46H94N4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-49(43-45(3)41-47)39-40-50(44-46(4)42-48)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,45-46H,5-18,23-44,47-48H2,1-4H3/b21-19-,22-20- |
| InChIKey | KWUPKVPGKZQSSE-WRBBJXAJSA-N |
| XLogP | 12.85 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.29 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|