C48H98N4 — CID 89206135
N'-[2-[(3-amino-2-methylpropyl)-[(E)-nonadec-9-enyl]amino]ethyl]-2-methyl-N'-[(E)-nonadec-9-enyl]propane-1,3-diamine (PubChem CID 89206135) has the molecular formula C48H98N4 and a molecular weight of 731.34 g/mol. Its IUPAC name is N'-[2-[(3-amino-2-methylpropyl)-[(E)-nonadec-9-enyl]amino]ethyl]-2-methyl-N'-[(E)-nonadec-9-enyl]propane-1,3-diamine.
| Compound Name | N'-[2-[(3-amino-2-methylpropyl)-[(E)-nonadec-9-enyl]amino]ethyl]-2-methyl-N'-[(E)-nonadec-9-enyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 89206135 |
| Molecular Formula | C48H98N4 |
| Molecular Weight | 731.34 g/mol |
| Exact Mass | 730.78 |
| IUPAC Name | N'-[2-[(3-amino-2-methylpropyl)-[(E)-nonadec-9-enyl]amino]ethyl]-2-methyl-N'-[(E)-nonadec-9-enyl]propane-1,3-diamine |
| SMILES | CCCCCCCCC/C=C/CCCCCCCCN(CCN(CCCCCCCC/C=C/CCCCCCCCC)CC(C)CN)CC(C)CN |
| InChI | InChI=1S/C48H98N4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-51(45-47(3)43-49)41-42-52(46-48(4)44-50)40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h21-24,47-48H,5-20,25-46,49-50H2,1-4H3/b23-21+,24-22+ |
| InChIKey | HDWASQMRNADWGO-MBALSZOMSA-N |
| XLogP | 13.64 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.34 |
| LogP ≤ 5 | 13.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|