C30H51NO3 — CID 171428782
(4Z,7Z,10Z)-1-[4-hydroxybutyl-[(4Z,7Z,10Z)-2-hydroxytrideca-4,7,10-trienyl]amino]trideca-4,7,10-trien-2-ol (PubChem CID 171428782) has the molecular formula C30H51NO3 and a molecular weight of 473.74 g/mol. Its IUPAC name is (4Z,7Z,10Z)-1-[4-hydroxybutyl-[(4Z,7Z,10Z)-2-hydroxytrideca-4,7,10-trienyl]amino]trideca-4,7,10-trien-2-ol.
| Compound Name | (4Z,7Z,10Z)-1-[4-hydroxybutyl-[(4Z,7Z,10Z)-2-hydroxytrideca-4,7,10-trienyl]amino]trideca-4,7,10-trien-2-ol |
|---|---|
| PubChem CID | 171428782 |
| Molecular Formula | C30H51NO3 |
| Molecular Weight | 473.74 g/mol |
| Exact Mass | 473.39 |
| IUPAC Name | (4Z,7Z,10Z)-1-[4-hydroxybutyl-[(4Z,7Z,10Z)-2-hydroxytrideca-4,7,10-trienyl]amino]trideca-4,7,10-trien-2-ol |
| SMILES | CC/C=C\C/C=C\C/C=C\CC(O)CN(CCCCO)CC(O)C/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C30H51NO3/c1-3-5-7-9-11-13-15-17-19-23-29(33)27-31(25-21-22-26-32)28-30(34)24-20-18-16-14-12-10-8-6-4-2/h5-8,11-14,17-20,29-30,32-34H,3-4,9-10,15-16,21-28H2,1-2H3/b7-5-,8-6-,13-11-,14-12-,19-17-,20-18- |
| InChIKey | GOWQWLQDGQCBTH-YTWBPVBXSA-N |
| XLogP | 6.28 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.74 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|