C46H84N4O6 — CID 161055103
3-[4-[bis[(Z)-2-hydroxyhept-4-enyl]amino]butyl]-6-[4-[[(Z)-2-hydroxyhept-4-enyl]-[(Z)-2-hydroxytridec-4-enyl]amino]butyl]piperazine-2,5-dione (PubChem CID 161055103) has the molecular formula C46H84N4O6 and a molecular weight of 789.20 g/mol. Its IUPAC name is 3-[4-[bis[(Z)-2-hydroxyhept-4-enyl]amino]butyl]-6-[4-[[(Z)-2-hydroxyhept-4-enyl]-[(Z)-2-hydroxytridec-4-enyl]amino]butyl]piperazine-2,5-dione.
| Compound Name | 3-[4-[bis[(Z)-2-hydroxyhept-4-enyl]amino]butyl]-6-[4-[[(Z)-2-hydroxyhept-4-enyl]-[(Z)-2-hydroxytridec-4-enyl]amino]butyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 161055103 |
| Molecular Formula | C46H84N4O6 |
| Molecular Weight | 789.20 g/mol |
| Exact Mass | 788.64 |
| IUPAC Name | 3-[4-[bis[(Z)-2-hydroxyhept-4-enyl]amino]butyl]-6-[4-[[(Z)-2-hydroxyhept-4-enyl]-[(Z)-2-hydroxytridec-4-enyl]amino]butyl]piperazine-2,5-dione |
| SMILES | CC/C=C\CC(O)CN(CCCCC1NC(=O)C(CCCCN(CC(O)C/C=C\CC)CC(O)C/C=C\CCCCCCCC)NC1=O)CC(O)C/C=C\CC |
| InChI | InChI=1S/C46H84N4O6/c1-5-9-13-14-15-16-17-18-22-30-42(54)38-50(37-41(53)29-21-12-8-4)34-26-24-32-44-46(56)47-43(45(55)48-44)31-23-25-33-49(35-39(51)27-19-10-6-2)36-40(52)28-20-11-7-3/h10-12,18-22,39-44,51-54H,5-9,13-17,23-38H2,1-4H3,(H,47,56)(H,48,55)/b19-10-,20-11-,21-12-,22-18- |
| InChIKey | UCQJJHKECDHWGQ-GAAZSWQISA-N |
| XLogP | 7.12 |
| TPSA | 145.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.20 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|