C44H88N4O8 — CID 167380831
3,6-bis[2-[2-[bis(2-hydroxyoctyl)amino]ethoxy]ethyl]piperazine-2,5-dione (PubChem CID 167380831) has the molecular formula C44H88N4O8 and a molecular weight of 801.21 g/mol. Its IUPAC name is 3,6-bis[2-[2-[bis(2-hydroxyoctyl)amino]ethoxy]ethyl]piperazine-2,5-dione.
| Compound Name | 3,6-bis[2-[2-[bis(2-hydroxyoctyl)amino]ethoxy]ethyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 167380831 |
| Molecular Formula | C44H88N4O8 |
| Molecular Weight | 801.21 g/mol |
| Exact Mass | 800.66 |
| IUPAC Name | 3,6-bis[2-[2-[bis(2-hydroxyoctyl)amino]ethoxy]ethyl]piperazine-2,5-dione |
| SMILES | CCCCCCC(O)CN(CCOCCC1NC(=O)C(CCOCCN(CC(O)CCCCCC)CC(O)CCCCCC)NC1=O)CC(O)CCCCCC |
| InChI | InChI=1S/C44H88N4O8/c1-5-9-13-17-21-37(49)33-47(34-38(50)22-18-14-10-6-2)27-31-55-29-25-41-43(53)46-42(44(54)45-41)26-30-56-32-28-48(35-39(51)23-19-15-11-7-3)36-40(52)24-20-16-12-8-4/h37-42,49-52H,5-36H2,1-4H3,(H,45,54)(H,46,53) |
| InChIKey | ROGFMJLVSGKAIM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 164.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.21 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|