C56H108N4O10 — CID 153315865
2-[5-[2-[4-[bis(2-hydroxydecyl)amino]butanoyloxy]ethyl]-3,6-dioxopiperazin-2-yl]ethyl 4-[bis(2-hydroxydecyl)amino]butanoate (PubChem CID 153315865) has the molecular formula C56H108N4O10 and a molecular weight of 997.50 g/mol. Its IUPAC name is 2-[5-[2-[4-[bis(2-hydroxydecyl)amino]butanoyloxy]ethyl]-3,6-dioxopiperazin-2-yl]ethyl 4-[bis(2-hydroxydecyl)amino]butanoate.
| Compound Name | 2-[5-[2-[4-[bis(2-hydroxydecyl)amino]butanoyloxy]ethyl]-3,6-dioxopiperazin-2-yl]ethyl 4-[bis(2-hydroxydecyl)amino]butanoate |
|---|---|
| PubChem CID | 153315865 |
| Molecular Formula | C56H108N4O10 |
| Molecular Weight | 997.50 g/mol |
| Exact Mass | 996.81 |
| IUPAC Name | 2-[5-[2-[4-[bis(2-hydroxydecyl)amino]butanoyloxy]ethyl]-3,6-dioxopiperazin-2-yl]ethyl 4-[bis(2-hydroxydecyl)amino]butanoate |
| SMILES | CCCCCCCCC(O)CN(CCCC(=O)OCCC1NC(=O)C(CCOC(=O)CCCN(CC(O)CCCCCCCC)CC(O)CCCCCCCC)NC1=O)CC(O)CCCCCCCC |
| InChI | InChI=1S/C56H108N4O10/c1-5-9-13-17-21-25-31-47(61)43-59(44-48(62)32-26-22-18-14-10-6-2)39-29-35-53(65)69-41-37-51-55(67)58-52(56(68)57-51)38-42-70-54(66)36-30-40-60(45-49(63)33-27-23-19-15-11-7-3)46-50(64)34-28-24-20-16-12-8-4/h47-52,61-64H,5-46H2,1-4H3,(H,57,68)(H,58,67) |
| InChIKey | PKGGHWUNRQPXOQ-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 198.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 70 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 997.50 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|