C51H102N4O6 — CID 118603384
(3S,6R)-3-[4-[bis[(2R)-2-hydroxydodecyl]amino]butyl]-6-[4-[[(2R)-2-hydroxydodecyl]-[(2R)-2-hydroxypropyl]amino]butyl]piperazine-2,5-dione (PubChem CID 118603384) has the molecular formula C51H102N4O6 and a molecular weight of 867.40 g/mol. Its IUPAC name is (3S,6R)-3-[4-[bis[(2R)-2-hydroxydodecyl]amino]butyl]-6-[4-[[(2R)-2-hydroxydodecyl]-[(2R)-2-hydroxypropyl]amino]butyl]piperazine-2,5-dione.
| Compound Name | (3S,6R)-3-[4-[bis[(2R)-2-hydroxydodecyl]amino]butyl]-6-[4-[[(2R)-2-hydroxydodecyl]-[(2R)-2-hydroxypropyl]amino]butyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 118603384 |
| Molecular Formula | C51H102N4O6 |
| Molecular Weight | 867.40 g/mol |
| Exact Mass | 866.78 |
| IUPAC Name | (3S,6R)-3-[4-[bis[(2R)-2-hydroxydodecyl]amino]butyl]-6-[4-[[(2R)-2-hydroxydodecyl]-[(2R)-2-hydroxypropyl]amino]butyl]piperazine-2,5-dione |
| SMILES | CCCCCCCCCC[C@@H](O)CN(CCCC[C@@H]1NC(=O)[C@@H](CCCCN(C[C@H](O)CCCCCCCCCC)C[C@@H](C)O)NC1=O)C[C@H](O)CCCCCCCCCC |
| InChI | InChI=1S/C51H102N4O6/c1-5-8-11-14-17-20-23-26-33-45(57)41-54(40-44(4)56)38-31-29-36-48-50(60)53-49(51(61)52-48)37-30-32-39-55(42-46(58)34-27-24-21-18-15-12-9-6-2)43-47(59)35-28-25-22-19-16-13-10-7-3/h44-49,56-59H,5-43H2,1-4H3,(H,52,61)(H,53,60)/t44-,45-,46-,47-,48-,49+/m1/s1 |
| InChIKey | AUCLRSVDTAAPGS-QREVSMKPSA-N |
| XLogP | 9.97 |
| TPSA | 145.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.40 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|