C22H42Cl2N4O6 — CID 167202020
3-[4-[bis(2-chloro-2-hydroxyethyl)amino]butyl]-6-[4-[bis(2-hydroxypropyl)amino]butyl]piperazine-2,5-dione (PubChem CID 167202020) has the molecular formula C22H42Cl2N4O6 and a molecular weight of 529.51 g/mol. Its IUPAC name is 3-[4-[bis(2-chloro-2-hydroxyethyl)amino]butyl]-6-[4-[bis(2-hydroxypropyl)amino]butyl]piperazine-2,5-dione.
| Compound Name | 3-[4-[bis(2-chloro-2-hydroxyethyl)amino]butyl]-6-[4-[bis(2-hydroxypropyl)amino]butyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 167202020 |
| Molecular Formula | C22H42Cl2N4O6 |
| Molecular Weight | 529.51 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | 3-[4-[bis(2-chloro-2-hydroxyethyl)amino]butyl]-6-[4-[bis(2-hydroxypropyl)amino]butyl]piperazine-2,5-dione |
| SMILES | CC(O)CN(CCCCC1NC(=O)C(CCCCN(CC(O)Cl)CC(O)Cl)NC1=O)CC(C)O |
| InChI | InChI=1S/C22H42Cl2N4O6/c1-15(29)11-27(12-16(2)30)9-5-3-7-17-21(33)26-18(22(34)25-17)8-4-6-10-28(13-19(23)31)14-20(24)32/h15-20,29-32H,3-14H2,1-2H3,(H,25,34)(H,26,33) |
| InChIKey | KBWNYLZCVWHAIX-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 145.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.51 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|