C22H35N3O5 — CID 129239447
3-[4-[2-hydroxybutyl(2-hydroxypropyl)amino]butyl]-6-[(4-hydroxyphenyl)methyl]piperazine-2,5-dione (PubChem CID 129239447) has the molecular formula C22H35N3O5 and a molecular weight of 421.54 g/mol. Its IUPAC name is 3-[4-[2-hydroxybutyl(2-hydroxypropyl)amino]butyl]-6-[(4-hydroxyphenyl)methyl]piperazine-2,5-dione.
| Compound Name | 3-[4-[2-hydroxybutyl(2-hydroxypropyl)amino]butyl]-6-[(4-hydroxyphenyl)methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 129239447 |
| Molecular Formula | C22H35N3O5 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | 3-[4-[2-hydroxybutyl(2-hydroxypropyl)amino]butyl]-6-[(4-hydroxyphenyl)methyl]piperazine-2,5-dione |
| SMILES | CCC(O)CN(CCCCC1NC(=O)C(Cc2ccc(O)cc2)NC1=O)CC(C)O |
| InChI | InChI=1S/C22H35N3O5/c1-3-17(27)14-25(13-15(2)26)11-5-4-6-19-21(29)24-20(22(30)23-19)12-16-7-9-18(28)10-8-16/h7-10,15,17,19-20,26-28H,3-6,11-14H2,1-2H3,(H,23,30)(H,24,29) |
| InChIKey | JFNKBTHHJRZJFM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|