C22H44N4O6 — CID 118616215
(3R,6S)-3,6-bis[4-[2-hydroxyethyl-[(2R)-2-hydroxypropyl]amino]butyl]piperazine-2,5-dione (PubChem CID 118616215) has the molecular formula C22H44N4O6 and a molecular weight of 460.62 g/mol. Its IUPAC name is (3R,6S)-3,6-bis[4-[2-hydroxyethyl-[(2R)-2-hydroxypropyl]amino]butyl]piperazine-2,5-dione.
| Compound Name | (3R,6S)-3,6-bis[4-[2-hydroxyethyl-[(2R)-2-hydroxypropyl]amino]butyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 118616215 |
| Molecular Formula | C22H44N4O6 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.33 |
| IUPAC Name | (3R,6S)-3,6-bis[4-[2-hydroxyethyl-[(2R)-2-hydroxypropyl]amino]butyl]piperazine-2,5-dione |
| SMILES | C[C@@H](O)CN(CCO)CCCC[C@@H]1NC(=O)[C@@H](CCCCN(CCO)C[C@@H](C)O)NC1=O |
| InChI | InChI=1S/C22H44N4O6/c1-17(29)15-25(11-13-27)9-5-3-7-19-21(31)24-20(22(32)23-19)8-4-6-10-26(12-14-28)16-18(2)30/h17-20,27-30H,3-16H2,1-2H3,(H,23,32)(H,24,31)/t17-,18-,19-,20+/m1/s1 |
| InChIKey | KLHJNKCEPGZZTN-WTGUMLROSA-N |
| XLogP | -1.34 |
| TPSA | 145.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|