C16H31N3O5 — CID 147749001
3-[4-[bis(2-hydroxypropyl)amino]butyl]-6-(1-hydroxyethyl)piperazine-2,5-dione (PubChem CID 147749001) has the molecular formula C16H31N3O5 and a molecular weight of 345.44 g/mol. Its IUPAC name is 3-[4-[bis(2-hydroxypropyl)amino]butyl]-6-(1-hydroxyethyl)piperazine-2,5-dione.
| Compound Name | 3-[4-[bis(2-hydroxypropyl)amino]butyl]-6-(1-hydroxyethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 147749001 |
| Molecular Formula | C16H31N3O5 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 3-[4-[bis(2-hydroxypropyl)amino]butyl]-6-(1-hydroxyethyl)piperazine-2,5-dione |
| SMILES | CC(O)CN(CCCCC1NC(=O)C(C(C)O)NC1=O)CC(C)O |
| InChI | InChI=1S/C16H31N3O5/c1-10(20)8-19(9-11(2)21)7-5-4-6-13-15(23)18-14(12(3)22)16(24)17-13/h10-14,20-22H,4-9H2,1-3H3,(H,17,24)(H,18,23) |
| InChIKey | HBVGSCJWHTXFFP-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|