C28H47NO2S — CID 177089833
(4Z,7Z,10Z)-1-[[(4Z,7Z,10Z)-2-hydroxytrideca-4,7,10-trienyl]-(2-sulfanylethyl)amino]trideca-4,7,10-trien-2-ol (PubChem CID 177089833) has the molecular formula C28H47NO2S and a molecular weight of 461.76 g/mol. Its IUPAC name is (4Z,7Z,10Z)-1-[[(4Z,7Z,10Z)-2-hydroxytrideca-4,7,10-trienyl]-(2-sulfanylethyl)amino]trideca-4,7,10-trien-2-ol.
| Compound Name | (4Z,7Z,10Z)-1-[[(4Z,7Z,10Z)-2-hydroxytrideca-4,7,10-trienyl]-(2-sulfanylethyl)amino]trideca-4,7,10-trien-2-ol |
|---|---|
| PubChem CID | 177089833 |
| Molecular Formula | C28H47NO2S |
| Molecular Weight | 461.76 g/mol |
| Exact Mass | 461.33 |
| IUPAC Name | (4Z,7Z,10Z)-1-[[(4Z,7Z,10Z)-2-hydroxytrideca-4,7,10-trienyl]-(2-sulfanylethyl)amino]trideca-4,7,10-trien-2-ol |
| SMILES | CC/C=C\C/C=C\C/C=C\CC(O)CN(CCS)CC(O)C/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C28H47NO2S/c1-3-5-7-9-11-13-15-17-19-21-27(30)25-29(23-24-32)26-28(31)22-20-18-16-14-12-10-8-6-4-2/h5-8,11-14,17-20,27-28,30-32H,3-4,9-10,15-16,21-26H2,1-2H3/b7-5-,8-6-,13-11-,14-12-,19-17-,20-18- |
| InChIKey | QDXWRCCEVMOHNA-YTWBPVBXSA-N |
| XLogP | 6.44 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.76 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|