C24H38OS — CID 142701093
(6E,9E,12E,15E,18E,21E)-1-sulfanyltetracosa-6,9,12,15,18,21-hexaen-3-ol (PubChem CID 142701093) has the molecular formula C24H38OS and a molecular weight of 374.63 g/mol. Its IUPAC name is (6E,9E,12E,15E,18E,21E)-1-sulfanyltetracosa-6,9,12,15,18,21-hexaen-3-ol.
| Compound Name | (6E,9E,12E,15E,18E,21E)-1-sulfanyltetracosa-6,9,12,15,18,21-hexaen-3-ol |
|---|---|
| PubChem CID | 142701093 |
| Molecular Formula | C24H38OS |
| Molecular Weight | 374.63 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | (6E,9E,12E,15E,18E,21E)-1-sulfanyltetracosa-6,9,12,15,18,21-hexaen-3-ol |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCC(O)CCS |
| InChI | InChI=1S/C24H38OS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24(25)22-23-26/h3-4,6-7,9-10,12-13,15-16,18-19,24-26H,2,5,8,11,14,17,20-23H2,1H3/b4-3+,7-6+,10-9+,13-12+,16-15+,19-18+ |
| InChIKey | IORCXELYMBNEKD-SFGLVEFQSA-N |
| XLogP | 7.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.63 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|