C13H22O — CID 140806984
2-ethylundeca-5,8-dienal (PubChem CID 140806984) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is 2-ethylundeca-5,8-dienal.
| Compound Name | 2-ethylundeca-5,8-dienal |
|---|---|
| PubChem CID | 140806984 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 2-ethylundeca-5,8-dienal |
| SMILES | CCC=CCC=CCCC(C=O)CC |
| InChI | InChI=1S/C13H22O/c1-3-5-6-7-8-9-10-11-13(4-2)12-14/h5-6,8-9,12-13H,3-4,7,10-11H2,1-2H3 |
| InChIKey | AGDDYCOKNDVJLB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|