C16H28O — CID 118354605
(5E,8E)-2-ethyltetradeca-5,8-dienal (PubChem CID 118354605) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is (5E,8E)-2-ethyltetradeca-5,8-dienal.
| Compound Name | (5E,8E)-2-ethyltetradeca-5,8-dienal |
|---|---|
| PubChem CID | 118354605 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | (5E,8E)-2-ethyltetradeca-5,8-dienal |
| SMILES | CCCCC/C=C/C/C=C/CCC(C=O)CC |
| InChI | InChI=1S/C16H28O/c1-3-5-6-7-8-9-10-11-12-13-14-16(4-2)15-17/h8-9,11-12,15-16H,3-7,10,13-14H2,1-2H3/b9-8+,12-11+ |
| InChIKey | LHOVOTUKQFHNDM-MVKOLZDDSA-N |
| XLogP | 5.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|