About 2-ethylheptadecanal
2-ethylheptadecanal (PubChem CID 18629573) has the molecular formula C19H38O
and a molecular weight of 282.51 g/mol. Its IUPAC name is 2-ethylheptadecanal.
Molecular Properties
| Compound Name | 2-ethylheptadecanal |
| PubChem CID | 18629573 |
| Molecular Formula | C19H38O |
| Molecular Weight | 282.51 g/mol |
| Exact Mass | 282.29 |
| IUPAC Name | 2-ethylheptadecanal |
| SMILES | CCCCCCCCCCCCCCCC(C=O)CC |
| InChI | InChI=1S/C19H38O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-19(4-2)18-20/h18-19H,3-17H2,1-2H3 |
| InChIKey | JTJHUJKROKHLLW-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.51 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylheptadecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylheptadecanal?
The IUPAC name of 2-ethylheptadecanal (CID 18629573) is 2-ethylheptadecanal.
What is the SMILES notation for 2-ethylheptadecanal?
The canonical SMILES for 2-ethylheptadecanal is CCCCCCCCCCCCCCCC(C=O)CC.
What is the InChIKey of 2-ethylheptadecanal?
The InChIKey is JTJHUJKROKHLLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-19(4-2)18-20/h18-19H,3-17H2,1-2H3.
What are the key properties of 2-ethylheptadecanal?
2-ethylheptadecanal has a molecular weight of 282.51 g/mol, XLogP of 6.69, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylheptadecanal is sourced from PubChem (CID 18629573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).