About 2-dodecylbutanedial
2-dodecylbutanedial (PubChem CID 19787656) has the molecular formula C16H30O2
and a molecular weight of 254.41 g/mol. Its IUPAC name is 2-dodecylbutanedial.
Molecular Properties
| Compound Name | 2-dodecylbutanedial |
| PubChem CID | 19787656 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 2-dodecylbutanedial |
| SMILES | CCCCCCCCCCCCC(C=O)CC=O |
| InChI | InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-16(15-18)13-14-17/h14-16H,2-13H2,1H3 |
| InChIKey | ICHRXOOVEYHKKN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-dodecylbutanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dodecylbutanedial?
The IUPAC name of 2-dodecylbutanedial (CID 19787656) is 2-dodecylbutanedial.
What is the SMILES notation for 2-dodecylbutanedial?
The canonical SMILES for 2-dodecylbutanedial is CCCCCCCCCCCCC(C=O)CC=O.
What is the InChIKey of 2-dodecylbutanedial?
The InChIKey is ICHRXOOVEYHKKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-16(15-18)13-14-17/h14-16H,2-13H2,1H3.
What are the key properties of 2-dodecylbutanedial?
2-dodecylbutanedial has a molecular weight of 254.41 g/mol, XLogP of 4.70, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dodecylbutanedial is sourced from PubChem (CID 19787656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).