About 2-(2-aminoethyl)heptanal
2-(2-aminoethyl)heptanal (PubChem CID 163417417) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is 2-(2-aminoethyl)heptanal.
Molecular Properties
| Compound Name | 2-(2-aminoethyl)heptanal |
| PubChem CID | 163417417 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | 2-(2-aminoethyl)heptanal |
| SMILES | CCCCCC(C=O)CCN |
| InChI | InChI=1S/C9H19NO/c1-2-3-4-5-9(8-11)6-7-10/h8-9H,2-7,10H2,1H3 |
| InChIKey | AFPWTBXPAULQME-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminoethyl)heptanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethyl)heptanal?
The IUPAC name of 2-(2-aminoethyl)heptanal (CID 163417417) is 2-(2-aminoethyl)heptanal.
What is the SMILES notation for 2-(2-aminoethyl)heptanal?
The canonical SMILES for 2-(2-aminoethyl)heptanal is CCCCCC(C=O)CCN.
What is the InChIKey of 2-(2-aminoethyl)heptanal?
The InChIKey is AFPWTBXPAULQME-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO/c1-2-3-4-5-9(8-11)6-7-10/h8-9H,2-7,10H2,1H3.
What are the key properties of 2-(2-aminoethyl)heptanal?
2-(2-aminoethyl)heptanal has a molecular weight of 157.26 g/mol, XLogP of 1.73, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethyl)heptanal is sourced from PubChem (CID 163417417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).