About 2-(2-chloroethyl)decanal
2-(2-chloroethyl)decanal (PubChem CID 175197412) has the molecular formula C12H23ClO
and a molecular weight of 218.77 g/mol. Its IUPAC name is 2-(2-chloroethyl)decanal.
Molecular Properties
| Compound Name | 2-(2-chloroethyl)decanal |
| PubChem CID | 175197412 |
| Molecular Formula | C12H23ClO |
| Molecular Weight | 218.77 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 2-(2-chloroethyl)decanal |
| SMILES | CCCCCCCCC(C=O)CCCl |
| InChI | InChI=1S/C12H23ClO/c1-2-3-4-5-6-7-8-12(11-14)9-10-13/h11-12H,2-10H2,1H3 |
| InChIKey | AQKAGCUQFHDYEG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.77 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chloroethyl)decanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloroethyl)decanal?
The IUPAC name of 2-(2-chloroethyl)decanal (CID 175197412) is 2-(2-chloroethyl)decanal.
What is the SMILES notation for 2-(2-chloroethyl)decanal?
The canonical SMILES for 2-(2-chloroethyl)decanal is CCCCCCCCC(C=O)CCCl.
What is the InChIKey of 2-(2-chloroethyl)decanal?
The InChIKey is AQKAGCUQFHDYEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23ClO/c1-2-3-4-5-6-7-8-12(11-14)9-10-13/h11-12H,2-10H2,1H3.
What are the key properties of 2-(2-chloroethyl)decanal?
2-(2-chloroethyl)decanal has a molecular weight of 218.77 g/mol, XLogP of 4.18, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloroethyl)decanal is sourced from PubChem (CID 175197412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).