About 2-undecylpropanedial
2-undecylpropanedial (PubChem CID 20505732) has the molecular formula C14H26O2
and a molecular weight of 226.36 g/mol. Its IUPAC name is 2-undecylpropanedial.
Molecular Properties
| Compound Name | 2-undecylpropanedial |
| PubChem CID | 20505732 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 2-undecylpropanedial |
| SMILES | CCCCCCCCCCCC(C=O)C=O |
| InChI | InChI=1S/C14H26O2/c1-2-3-4-5-6-7-8-9-10-11-14(12-15)13-16/h12-14H,2-11H2,1H3 |
| InChIKey | ZZVVECIISLGLIE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-undecylpropanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-undecylpropanedial?
The IUPAC name of 2-undecylpropanedial (CID 20505732) is 2-undecylpropanedial.
What is the SMILES notation for 2-undecylpropanedial?
The canonical SMILES for 2-undecylpropanedial is CCCCCCCCCCCC(C=O)C=O.
What is the InChIKey of 2-undecylpropanedial?
The InChIKey is ZZVVECIISLGLIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O2/c1-2-3-4-5-6-7-8-9-10-11-14(12-15)13-16/h12-14H,2-11H2,1H3.
What are the key properties of 2-undecylpropanedial?
2-undecylpropanedial has a molecular weight of 226.36 g/mol, XLogP of 3.92, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-undecylpropanedial is sourced from PubChem (CID 20505732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).