About 4-aminopentadecanal
4-aminopentadecanal (PubChem CID 91108576) has the molecular formula C15H31NO
and a molecular weight of 241.42 g/mol. Its IUPAC name is 4-aminopentadecanal.
Molecular Properties
| Compound Name | 4-aminopentadecanal |
| PubChem CID | 91108576 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | 4-aminopentadecanal |
| SMILES | CCCCCCCCCCCC(N)CCC=O |
| InChI | InChI=1S/C15H31NO/c1-2-3-4-5-6-7-8-9-10-12-15(16)13-11-14-17/h14-15H,2-13,16H2,1H3 |
| InChIKey | SCBODUHNMOUCAP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-aminopentadecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminopentadecanal?
The IUPAC name of 4-aminopentadecanal (CID 91108576) is 4-aminopentadecanal.
What is the SMILES notation for 4-aminopentadecanal?
The canonical SMILES for 4-aminopentadecanal is CCCCCCCCCCCC(N)CCC=O.
What is the InChIKey of 4-aminopentadecanal?
The InChIKey is SCBODUHNMOUCAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO/c1-2-3-4-5-6-7-8-9-10-12-15(16)13-11-14-17/h14-15H,2-13,16H2,1H3.
What are the key properties of 4-aminopentadecanal?
4-aminopentadecanal has a molecular weight of 241.42 g/mol, XLogP of 4.21, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminopentadecanal is sourced from PubChem (CID 91108576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).