About 2-hydroxyhexanal;2-hydroxyoctanal
2-hydroxyhexanal;2-hydroxyoctanal (PubChem CID 146305584) has the molecular formula C14H28O4
and a molecular weight of 260.37 g/mol. Its IUPAC name is 2-hydroxyhexanal;2-hydroxyoctanal.
Molecular Properties
| Compound Name | 2-hydroxyhexanal;2-hydroxyoctanal |
| PubChem CID | 146305584 |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 2-hydroxyhexanal;2-hydroxyoctanal |
| SMILES | CCCCC(O)C=O.CCCCCCC(O)C=O |
| InChI | InChI=1S/C8H16O2.C6H12O2/c1-2-3-4-5-6-8(10)7-9;1-2-3-4-6(8)5-7/h7-8,10H,2-6H2,1H3;5-6,8H,2-4H2,1H3 |
| InChIKey | RAELENWVFWDDQV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyhexanal;2-hydroxyoctanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyhexanal;2-hydroxyoctanal?
The IUPAC name of 2-hydroxyhexanal;2-hydroxyoctanal (CID 146305584) is 2-hydroxyhexanal;2-hydroxyoctanal.
What is the SMILES notation for 2-hydroxyhexanal;2-hydroxyoctanal?
The canonical SMILES for 2-hydroxyhexanal;2-hydroxyoctanal is CCCCC(O)C=O.CCCCCCC(O)C=O.
What is the InChIKey of 2-hydroxyhexanal;2-hydroxyoctanal?
The InChIKey is RAELENWVFWDDQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.C6H12O2/c1-2-3-4-5-6-8(10)7-9;1-2-3-4-6(8)5-7/h7-8,10H,2-6H2,1H3;5-6,8H,2-4H2,1H3.
What are the key properties of 2-hydroxyhexanal;2-hydroxyoctanal?
2-hydroxyhexanal;2-hydroxyoctanal has a molecular weight of 260.37 g/mol, XLogP of 2.25, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyhexanal;2-hydroxyoctanal is sourced from PubChem (CID 146305584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).