About (2S)-2-fluorohexadecanal
(2S)-2-fluorohexadecanal (PubChem CID 134857256) has the molecular formula C16H31FO
and a molecular weight of 258.42 g/mol. Its IUPAC name is (2S)-2-fluorohexadecanal.
Molecular Properties
| Compound Name | (2S)-2-fluorohexadecanal |
| PubChem CID | 134857256 |
| Molecular Formula | C16H31FO |
| Molecular Weight | 258.42 g/mol |
| Exact Mass | 258.24 |
| IUPAC Name | (2S)-2-fluorohexadecanal |
| SMILES | CCCCCCCCCCCCCC[C@H](F)C=O |
| InChI | InChI=1S/C16H31FO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16(17)15-18/h15-16H,2-14H2,1H3/t16-/m0/s1 |
| InChIKey | VSZOVRHQNWNNFB-INIZCTEOSA-N |
| XLogP | 5.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.42 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-fluorohexadecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-fluorohexadecanal?
The IUPAC name of (2S)-2-fluorohexadecanal (CID 134857256) is (2S)-2-fluorohexadecanal.
What is the SMILES notation for (2S)-2-fluorohexadecanal?
The canonical SMILES for (2S)-2-fluorohexadecanal is CCCCCCCCCCCCCC[C@H](F)C=O.
What is the InChIKey of (2S)-2-fluorohexadecanal?
The InChIKey is VSZOVRHQNWNNFB-INIZCTEOSA-N. The full InChI is InChI=1S/C16H31FO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16(17)15-18/h15-16H,2-14H2,1H3/t16-/m0/s1.
What are the key properties of (2S)-2-fluorohexadecanal?
(2S)-2-fluorohexadecanal has a molecular weight of 258.42 g/mol, XLogP of 5.61, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-fluorohexadecanal is sourced from PubChem (CID 134857256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).