About (Z,2R)-2-fluorodec-7-enal
(Z,2R)-2-fluorodec-7-enal (PubChem CID 134894209) has the molecular formula C10H17FO
and a molecular weight of 172.24 g/mol. Its IUPAC name is (Z,2R)-2-fluorodec-7-enal.
Molecular Properties
| Compound Name | (Z,2R)-2-fluorodec-7-enal |
| PubChem CID | 134894209 |
| Molecular Formula | C10H17FO |
| Molecular Weight | 172.24 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | (Z,2R)-2-fluorodec-7-enal |
| SMILES | CC/C=C\CCCC[C@@H](F)C=O |
| InChI | InChI=1S/C10H17FO/c1-2-3-4-5-6-7-8-10(11)9-12/h3-4,9-10H,2,5-8H2,1H3/b4-3-/t10-/m1/s1 |
| InChIKey | QPKDUHGIUATXQB-UMBAGQNISA-N |
| XLogP | 3.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z,2R)-2-fluorodec-7-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,2R)-2-fluorodec-7-enal?
The IUPAC name of (Z,2R)-2-fluorodec-7-enal (CID 134894209) is (Z,2R)-2-fluorodec-7-enal.
What is the SMILES notation for (Z,2R)-2-fluorodec-7-enal?
The canonical SMILES for (Z,2R)-2-fluorodec-7-enal is CC/C=C\CCCC[C@@H](F)C=O.
What is the InChIKey of (Z,2R)-2-fluorodec-7-enal?
The InChIKey is QPKDUHGIUATXQB-UMBAGQNISA-N. The full InChI is InChI=1S/C10H17FO/c1-2-3-4-5-6-7-8-10(11)9-12/h3-4,9-10H,2,5-8H2,1H3/b4-3-/t10-/m1/s1.
What are the key properties of (Z,2R)-2-fluorodec-7-enal?
(Z,2R)-2-fluorodec-7-enal has a molecular weight of 172.24 g/mol, XLogP of 3.05, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,2R)-2-fluorodec-7-enal is sourced from PubChem (CID 134894209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).