About (Z)-non-6-ene-1,1-diol
(Z)-non-6-ene-1,1-diol (PubChem CID 170555028) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is (Z)-non-6-ene-1,1-diol.
Molecular Properties
| Compound Name | (Z)-non-6-ene-1,1-diol |
| PubChem CID | 170555028 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | (Z)-non-6-ene-1,1-diol |
| SMILES | CC/C=C\CCCCC(O)O |
| InChI | InChI=1S/C9H18O2/c1-2-3-4-5-6-7-8-9(10)11/h3-4,9-11H,2,5-8H2,1H3/b4-3- |
| InChIKey | VABRTCIRBVJBMM-ARJAWSKDSA-N |
| XLogP | 1.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-non-6-ene-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-non-6-ene-1,1-diol?
The IUPAC name of (Z)-non-6-ene-1,1-diol (CID 170555028) is (Z)-non-6-ene-1,1-diol.
What is the SMILES notation for (Z)-non-6-ene-1,1-diol?
The canonical SMILES for (Z)-non-6-ene-1,1-diol is CC/C=C\CCCCC(O)O.
What is the InChIKey of (Z)-non-6-ene-1,1-diol?
The InChIKey is VABRTCIRBVJBMM-ARJAWSKDSA-N. The full InChI is InChI=1S/C9H18O2/c1-2-3-4-5-6-7-8-9(10)11/h3-4,9-11H,2,5-8H2,1H3/b4-3-.
What are the key properties of (Z)-non-6-ene-1,1-diol?
(Z)-non-6-ene-1,1-diol has a molecular weight of 158.24 g/mol, XLogP of 1.82, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-non-6-ene-1,1-diol is sourced from PubChem (CID 170555028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).