About hexadec-13-en-5-yn-7-ol
hexadec-13-en-5-yn-7-ol (PubChem CID 71428203) has the molecular formula C16H28O
and a molecular weight of 236.40 g/mol. Its IUPAC name is hexadec-13-en-5-yn-7-ol.
Molecular Properties
| Compound Name | hexadec-13-en-5-yn-7-ol |
| PubChem CID | 71428203 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | hexadec-13-en-5-yn-7-ol |
| SMILES | CCC=CCCCCCC(O)C#CCCCC |
| InChI | InChI=1S/C16H28O/c1-3-5-7-9-10-11-13-15-16(17)14-12-8-6-4-2/h5,7,16-17H,3-4,6,8-11,13,15H2,1-2H3 |
| InChIKey | QYSHSBOHQOMIBI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze hexadec-13-en-5-yn-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadec-13-en-5-yn-7-ol?
The IUPAC name of hexadec-13-en-5-yn-7-ol (CID 71428203) is hexadec-13-en-5-yn-7-ol.
What is the SMILES notation for hexadec-13-en-5-yn-7-ol?
The canonical SMILES for hexadec-13-en-5-yn-7-ol is CCC=CCCCCCC(O)C#CCCCC.
What is the InChIKey of hexadec-13-en-5-yn-7-ol?
The InChIKey is QYSHSBOHQOMIBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O/c1-3-5-7-9-10-11-13-15-16(17)14-12-8-6-4-2/h5,7,16-17H,3-4,6,8-11,13,15H2,1-2H3.
What are the key properties of hexadec-13-en-5-yn-7-ol?
hexadec-13-en-5-yn-7-ol has a molecular weight of 236.40 g/mol, XLogP of 4.46, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexadec-13-en-5-yn-7-ol is sourced from PubChem (CID 71428203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).