C20H34O — CID 23523148
(9E,15E)-icosa-9,15-dien-7-yn-6-ol (PubChem CID 23523148) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is (9E,15E)-icosa-9,15-dien-7-yn-6-ol.
| Compound Name | (9E,15E)-icosa-9,15-dien-7-yn-6-ol |
|---|---|
| PubChem CID | 23523148 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | (9E,15E)-icosa-9,15-dien-7-yn-6-ol |
| SMILES | CCCC/C=C/CCCC/C=C/C#CC(O)CCCCC |
| InChI | InChI=1S/C20H34O/c1-3-5-7-8-9-10-11-12-13-14-15-17-19-20(21)18-16-6-4-2/h8-9,14-15,20-21H,3-7,10-13,16,18H2,1-2H3/b9-8+,15-14+ |
| InChIKey | LEKHNZRKZIMOJP-IDRAWEHWSA-N |
| XLogP | 5.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|