C25H48OSi — CID 102332031
(E,3R)-1-trimethylsilyldocos-13-en-1-yn-3-ol (PubChem CID 102332031) has the molecular formula C25H48OSi and a molecular weight of 392.74 g/mol. Its IUPAC name is (E,3R)-1-trimethylsilyldocos-13-en-1-yn-3-ol.
| Compound Name | (E,3R)-1-trimethylsilyldocos-13-en-1-yn-3-ol |
|---|---|
| PubChem CID | 102332031 |
| Molecular Formula | C25H48OSi |
| Molecular Weight | 392.74 g/mol |
| Exact Mass | 392.35 |
| IUPAC Name | (E,3R)-1-trimethylsilyldocos-13-en-1-yn-3-ol |
| SMILES | CCCCCCCC/C=C/CCCCCCCCC[C@@H](O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C25H48OSi/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25(26)23-24-27(2,3)4/h12-13,25-26H,5-11,14-22H2,1-4H3/b13-12+/t25-/m1/s1 |
| InChIKey | KHPDBQWBEMSXBE-ZOGNMOHXSA-N |
| XLogP | 8.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.74 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|