C23H38O2 — CID 162886871
(6R)-tricos-16-en-2,4-diyne-1,6-diol (PubChem CID 162886871) has the molecular formula C23H38O2 and a molecular weight of 346.56 g/mol. Its IUPAC name is (6R)-tricos-16-en-2,4-diyne-1,6-diol.
| Compound Name | (6R)-tricos-16-en-2,4-diyne-1,6-diol |
|---|---|
| PubChem CID | 162886871 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | (6R)-tricos-16-en-2,4-diyne-1,6-diol |
| SMILES | CCCCCCC=CCCCCCCCCC[C@@H](O)C#CC#CCO |
| InChI | InChI=1S/C23H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-20-23(25)21-18-16-19-22-24/h7-8,23-25H,2-6,9-15,17,20,22H2,1H3/t23-/m1/s1 |
| InChIKey | NQDFXJORSBSWCT-HSZRJFAPSA-N |
| XLogP | 5.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|