C25H42O4 — CID 78106175
pentacos-16-en-2,4-diyne-1,6,7,8-tetrol (PubChem CID 78106175) has the molecular formula C25H42O4 and a molecular weight of 406.61 g/mol. Its IUPAC name is pentacos-16-en-2,4-diyne-1,6,7,8-tetrol.
| Compound Name | pentacos-16-en-2,4-diyne-1,6,7,8-tetrol |
|---|---|
| PubChem CID | 78106175 |
| Molecular Formula | C25H42O4 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | pentacos-16-en-2,4-diyne-1,6,7,8-tetrol |
| SMILES | CCCCCCCCC=CCCCCCCCC(O)C(O)C(O)C#CC#CCO |
| InChI | InChI=1S/C25H42O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-20-23(27)25(29)24(28)21-18-16-19-22-26/h9-10,23-29H,2-8,11-15,17,20,22H2,1H3 |
| InChIKey | OCOSAPZCXDXMOA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|