C15H24O3 — CID 46185437
(7R,8R)-pentadeca-2,4-diyne-1,7,8-triol (PubChem CID 46185437) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (7R,8R)-pentadeca-2,4-diyne-1,7,8-triol.
| Compound Name | (7R,8R)-pentadeca-2,4-diyne-1,7,8-triol |
|---|---|
| PubChem CID | 46185437 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (7R,8R)-pentadeca-2,4-diyne-1,7,8-triol |
| SMILES | CCCCCCC[C@@H](O)[C@H](O)CC#CC#CCO |
| InChI | InChI=1S/C15H24O3/c1-2-3-4-5-8-11-14(17)15(18)12-9-6-7-10-13-16/h14-18H,2-5,8,11-13H2,1H3/t14-,15-/m1/s1 |
| InChIKey | YTOCIIZDSJBVOI-HUUCEWRRSA-N |
| XLogP | 1.46 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|