C15H29NO2 — CID 101348411
(3R,4R)-3,4-dihydroxypentadecanenitrile (PubChem CID 101348411) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is (3R,4R)-3,4-dihydroxypentadecanenitrile.
| Compound Name | (3R,4R)-3,4-dihydroxypentadecanenitrile |
|---|---|
| PubChem CID | 101348411 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | (3R,4R)-3,4-dihydroxypentadecanenitrile |
| SMILES | CCCCCCCCCCC[C@@H](O)[C@H](O)CC#N |
| InChI | InChI=1S/C15H29NO2/c1-2-3-4-5-6-7-8-9-10-11-14(17)15(18)12-13-16/h14-15,17-18H,2-12H2,1H3/t14-,15-/m1/s1 |
| InChIKey | XNLMYEVZFVSISN-HUUCEWRRSA-N |
| XLogP | 3.54 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|