About 3-hexylnonanenitrile
3-hexylnonanenitrile (PubChem CID 174880695) has the molecular formula C15H29N
and a molecular weight of 223.40 g/mol. Its IUPAC name is 3-hexylnonanenitrile.
Molecular Properties
| Compound Name | 3-hexylnonanenitrile |
| PubChem CID | 174880695 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | 3-hexylnonanenitrile |
| SMILES | CCCCCCC(CC#N)CCCCCC |
| InChI | InChI=1S/C15H29N/c1-3-5-7-9-11-15(13-14-16)12-10-8-6-4-2/h15H,3-13H2,1-2H3 |
| InChIKey | YUUPESULUFATPA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hexylnonanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexylnonanenitrile?
The IUPAC name of 3-hexylnonanenitrile (CID 174880695) is 3-hexylnonanenitrile.
What is the SMILES notation for 3-hexylnonanenitrile?
The canonical SMILES for 3-hexylnonanenitrile is CCCCCCC(CC#N)CCCCCC.
What is the InChIKey of 3-hexylnonanenitrile?
The InChIKey is YUUPESULUFATPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N/c1-3-5-7-9-11-15(13-14-16)12-10-8-6-4-2/h15H,3-13H2,1-2H3.
What are the key properties of 3-hexylnonanenitrile?
3-hexylnonanenitrile has a molecular weight of 223.40 g/mol, XLogP of 5.46, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexylnonanenitrile is sourced from PubChem (CID 174880695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).