About 9-octyloctadecane
9-octyloctadecane (PubChem CID 54267850) has the molecular formula C26H54
and a molecular weight of 366.72 g/mol. Its IUPAC name is 9-octyloctadecane.
Molecular Properties
| Compound Name | 9-octyloctadecane |
| PubChem CID | 54267850 |
| Molecular Formula | C26H54 |
| Molecular Weight | 366.72 g/mol |
| Exact Mass | 366.42 |
| IUPAC Name | 9-octyloctadecane |
| SMILES | CCCCCCCCCC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C26H54/c1-4-7-10-13-16-19-22-25-26(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h26H,4-25H2,1-3H3 |
| InChIKey | RESGZVVOQKWRKN-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 22 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.72 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-octyloctadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-octyloctadecane?
The IUPAC name of 9-octyloctadecane (CID 54267850) is 9-octyloctadecane.
What is the SMILES notation for 9-octyloctadecane?
The canonical SMILES for 9-octyloctadecane is CCCCCCCCCC(CCCCCCCC)CCCCCCCC.
What is the InChIKey of 9-octyloctadecane?
The InChIKey is RESGZVVOQKWRKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H54/c1-4-7-10-13-16-19-22-25-26(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h26H,4-25H2,1-3H3.
What are the key properties of 9-octyloctadecane?
9-octyloctadecane has a molecular weight of 366.72 g/mol, XLogP of 10.24, 22 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-octyloctadecane is sourced from PubChem (CID 54267850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).