About 6-hexyltridecanenitrile
6-hexyltridecanenitrile (PubChem CID 129015600) has the molecular formula C19H37N
and a molecular weight of 279.51 g/mol. Its IUPAC name is 6-hexyltridecanenitrile.
Molecular Properties
| Compound Name | 6-hexyltridecanenitrile |
| PubChem CID | 129015600 |
| Molecular Formula | C19H37N |
| Molecular Weight | 279.51 g/mol |
| Exact Mass | 279.29 |
| IUPAC Name | 6-hexyltridecanenitrile |
| SMILES | CCCCCCCC(CCCCC#N)CCCCCC |
| InChI | InChI=1S/C19H37N/c1-3-5-7-9-12-16-19(15-11-8-6-4-2)17-13-10-14-18-20/h19H,3-17H2,1-2H3 |
| InChIKey | OKFVBMICIJUTMO-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 279.51 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-hexyltridecanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hexyltridecanenitrile?
The IUPAC name of 6-hexyltridecanenitrile (CID 129015600) is 6-hexyltridecanenitrile.
What is the SMILES notation for 6-hexyltridecanenitrile?
The canonical SMILES for 6-hexyltridecanenitrile is CCCCCCCC(CCCCC#N)CCCCCC.
What is the InChIKey of 6-hexyltridecanenitrile?
The InChIKey is OKFVBMICIJUTMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H37N/c1-3-5-7-9-12-16-19(15-11-8-6-4-2)17-13-10-14-18-20/h19H,3-17H2,1-2H3.
What are the key properties of 6-hexyltridecanenitrile?
6-hexyltridecanenitrile has a molecular weight of 279.51 g/mol, XLogP of 7.02, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hexyltridecanenitrile is sourced from PubChem (CID 129015600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).