About 3-ethylundecanenitrile
3-ethylundecanenitrile (PubChem CID 143365530) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is 3-ethylundecanenitrile.
Molecular Properties
| Compound Name | 3-ethylundecanenitrile |
| PubChem CID | 143365530 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 3-ethylundecanenitrile |
| SMILES | CCCCCCCCC(CC)CC#N |
| InChI | InChI=1S/C13H25N/c1-3-5-6-7-8-9-10-13(4-2)11-12-14/h13H,3-11H2,1-2H3 |
| InChIKey | WMMIMRUMLWVMBG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylundecanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylundecanenitrile?
The IUPAC name of 3-ethylundecanenitrile (CID 143365530) is 3-ethylundecanenitrile.
What is the SMILES notation for 3-ethylundecanenitrile?
The canonical SMILES for 3-ethylundecanenitrile is CCCCCCCCC(CC)CC#N.
What is the InChIKey of 3-ethylundecanenitrile?
The InChIKey is WMMIMRUMLWVMBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N/c1-3-5-6-7-8-9-10-13(4-2)11-12-14/h13H,3-11H2,1-2H3.
What are the key properties of 3-ethylundecanenitrile?
3-ethylundecanenitrile has a molecular weight of 195.35 g/mol, XLogP of 4.68, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylundecanenitrile is sourced from PubChem (CID 143365530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).