C10H19NO2 — CID 71379501
(5S)-3,5-dihydroxydecanenitrile (PubChem CID 71379501) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is (5S)-3,5-dihydroxydecanenitrile.
| Compound Name | (5S)-3,5-dihydroxydecanenitrile |
|---|---|
| PubChem CID | 71379501 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (5S)-3,5-dihydroxydecanenitrile |
| SMILES | CCCCC[C@H](O)CC(O)CC#N |
| InChI | InChI=1S/C10H19NO2/c1-2-3-4-5-9(12)8-10(13)6-7-11/h9-10,12-13H,2-6,8H2,1H3/t9-,10?/m0/s1 |
| InChIKey | GCMXOFVXJRXKHL-RGURZIINSA-N |
| XLogP | 1.59 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|