C17H26O3 — CID 163076687
(9S,10S)-9,10-dihydroxyheptadeca-4,6-diyn-3-one (PubChem CID 163076687) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (9S,10S)-9,10-dihydroxyheptadeca-4,6-diyn-3-one.
| Compound Name | (9S,10S)-9,10-dihydroxyheptadeca-4,6-diyn-3-one |
|---|---|
| PubChem CID | 163076687 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (9S,10S)-9,10-dihydroxyheptadeca-4,6-diyn-3-one |
| SMILES | CCCCCCC[C@H](O)[C@@H](O)CC#CC#CC(=O)CC |
| InChI | InChI=1S/C17H26O3/c1-3-5-6-7-10-13-16(19)17(20)14-11-8-9-12-15(18)4-2/h16-17,19-20H,3-7,10,13-14H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | VNLATJUGAZKQEH-IRXDYDNUSA-N |
| XLogP | 2.44 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|