C18H26O3 — CID 16655583
(9R,10R)-9-hydroxy-10-methoxyheptadec-1-en-4,6-diyn-3-one (PubChem CID 16655583) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (9R,10R)-9-hydroxy-10-methoxyheptadec-1-en-4,6-diyn-3-one.
| Compound Name | (9R,10R)-9-hydroxy-10-methoxyheptadec-1-en-4,6-diyn-3-one |
|---|---|
| PubChem CID | 16655583 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (9R,10R)-9-hydroxy-10-methoxyheptadec-1-en-4,6-diyn-3-one |
| SMILES | C=CC(=O)C#CC#CC[C@@H](O)[C@@H](CCCCCCC)OC |
| InChI | InChI=1S/C18H26O3/c1-4-6-7-8-12-15-18(21-3)17(20)14-11-9-10-13-16(19)5-2/h5,17-18,20H,2,4,6-8,12,14-15H2,1,3H3/t17-,18-/m1/s1 |
| InChIKey | FLDFUMKDDULMFL-QZTJIDSGSA-N |
| XLogP | 2.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|