About 2-methoxynonane-1,1-diol
2-methoxynonane-1,1-diol (PubChem CID 175114695) has the molecular formula C10H22O3
and a molecular weight of 190.28 g/mol. Its IUPAC name is 2-methoxynonane-1,1-diol.
Molecular Properties
| Compound Name | 2-methoxynonane-1,1-diol |
| PubChem CID | 175114695 |
| Molecular Formula | C10H22O3 |
| Molecular Weight | 190.28 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | 2-methoxynonane-1,1-diol |
| SMILES | CCCCCCCC(OC)C(O)O |
| InChI | InChI=1S/C10H22O3/c1-3-4-5-6-7-8-9(13-2)10(11)12/h9-12H,3-8H2,1-2H3 |
| InChIKey | VJAUROTWBWSICR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxynonane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxynonane-1,1-diol?
The IUPAC name of 2-methoxynonane-1,1-diol (CID 175114695) is 2-methoxynonane-1,1-diol.
What is the SMILES notation for 2-methoxynonane-1,1-diol?
The canonical SMILES for 2-methoxynonane-1,1-diol is CCCCCCCC(OC)C(O)O.
What is the InChIKey of 2-methoxynonane-1,1-diol?
The InChIKey is VJAUROTWBWSICR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O3/c1-3-4-5-6-7-8-9(13-2)10(11)12/h9-12H,3-8H2,1-2H3.
What are the key properties of 2-methoxynonane-1,1-diol?
2-methoxynonane-1,1-diol has a molecular weight of 190.28 g/mol, XLogP of 1.67, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxynonane-1,1-diol is sourced from PubChem (CID 175114695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).