About 1,1-dimethoxytetradecane
1,1-dimethoxytetradecane (PubChem CID 13265409) has the molecular formula C16H34O2
and a molecular weight of 258.45 g/mol. Its IUPAC name is 1,1-dimethoxytetradecane.
Molecular Properties
| Compound Name | 1,1-dimethoxytetradecane |
| PubChem CID | 13265409 |
| Molecular Formula | C16H34O2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.26 |
| IUPAC Name | 1,1-dimethoxytetradecane |
| SMILES | CCCCCCCCCCCCCC(OC)OC |
| InChI | InChI=1S/C16H34O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16(17-2)18-3/h16H,4-15H2,1-3H3 |
| InChIKey | UOUNLLQHXAHFDJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethoxytetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethoxytetradecane?
The IUPAC name of 1,1-dimethoxytetradecane (CID 13265409) is 1,1-dimethoxytetradecane.
What is the SMILES notation for 1,1-dimethoxytetradecane?
The canonical SMILES for 1,1-dimethoxytetradecane is CCCCCCCCCCCCCC(OC)OC.
What is the InChIKey of 1,1-dimethoxytetradecane?
The InChIKey is UOUNLLQHXAHFDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16(17-2)18-3/h16H,4-15H2,1-3H3.
What are the key properties of 1,1-dimethoxytetradecane?
1,1-dimethoxytetradecane has a molecular weight of 258.45 g/mol, XLogP of 5.31, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethoxytetradecane is sourced from PubChem (CID 13265409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).