About 12,12-dimethoxydodecan-1-ol
12,12-dimethoxydodecan-1-ol (PubChem CID 71412944) has the molecular formula C14H30O3
and a molecular weight of 246.39 g/mol. Its IUPAC name is 12,12-dimethoxydodecan-1-ol.
Molecular Properties
| Compound Name | 12,12-dimethoxydodecan-1-ol |
| PubChem CID | 71412944 |
| Molecular Formula | C14H30O3 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.22 |
| IUPAC Name | 12,12-dimethoxydodecan-1-ol |
| SMILES | COC(CCCCCCCCCCCO)OC |
| InChI | InChI=1S/C14H30O3/c1-16-14(17-2)12-10-8-6-4-3-5-7-9-11-13-15/h14-15H,3-13H2,1-2H3 |
| InChIKey | SPZVPDLVMDIUTJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 12,12-dimethoxydodecan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12,12-dimethoxydodecan-1-ol?
The IUPAC name of 12,12-dimethoxydodecan-1-ol (CID 71412944) is 12,12-dimethoxydodecan-1-ol.
What is the SMILES notation for 12,12-dimethoxydodecan-1-ol?
The canonical SMILES for 12,12-dimethoxydodecan-1-ol is COC(CCCCCCCCCCCO)OC.
What is the InChIKey of 12,12-dimethoxydodecan-1-ol?
The InChIKey is SPZVPDLVMDIUTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O3/c1-16-14(17-2)12-10-8-6-4-3-5-7-9-11-13-15/h14-15H,3-13H2,1-2H3.
What are the key properties of 12,12-dimethoxydodecan-1-ol?
12,12-dimethoxydodecan-1-ol has a molecular weight of 246.39 g/mol, XLogP of 3.50, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 12,12-dimethoxydodecan-1-ol is sourced from PubChem (CID 71412944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).