C9H19NO3 — CID 134986076
7,7-dimethoxyheptanamide (PubChem CID 134986076) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is 7,7-dimethoxyheptanamide.
| Compound Name | 7,7-dimethoxyheptanamide |
|---|---|
| PubChem CID | 134986076 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | 7,7-dimethoxyheptanamide |
| SMILES | COC(CCCCCC(N)=O)OC |
| InChI | InChI=1S/C9H19NO3/c1-12-9(13-2)7-5-3-4-6-8(10)11/h9H,3-7H2,1-2H3,(H2,10,11) |
| InChIKey | IJMWJGRJNHOSCR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|