C9H17Na2O6P — CID 88794857
disodium;7,7-dimethoxy-1-phosphonatoheptan-2-one (PubChem CID 88794857) has the molecular formula C9H17Na2O6P and a molecular weight of 298.18 g/mol. Its IUPAC name is disodium;7,7-dimethoxy-1-phosphonatoheptan-2-one.
| Compound Name | disodium;7,7-dimethoxy-1-phosphonatoheptan-2-one |
|---|---|
| PubChem CID | 88794857 |
| Molecular Formula | C9H17Na2O6P |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | disodium;7,7-dimethoxy-1-phosphonatoheptan-2-one |
| SMILES | COC(CCCCC(=O)CP(=O)([O-])[O-])OC.[Na+].[Na+] |
| InChI | InChI=1S/C9H19O6P.2Na/c1-14-9(15-2)6-4-3-5-8(10)7-16(11,12)13;;/h9H,3-7H2,1-2H3,(H2,11,12,13);;/q;2*+1/p-2 |
| InChIKey | HYXSADQTRFEYAT-UHFFFAOYSA-L |
| XLogP | -6.34 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | -6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|