C12H24O2 — CID 11252644
1,1-dimethoxy-7-methylidenenonane (PubChem CID 11252644) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is 1,1-dimethoxy-7-methylidenenonane.
| Compound Name | 1,1-dimethoxy-7-methylidenenonane |
|---|---|
| PubChem CID | 11252644 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 1,1-dimethoxy-7-methylidenenonane |
| SMILES | C=C(CC)CCCCCC(OC)OC |
| InChI | InChI=1S/C12H24O2/c1-5-11(2)9-7-6-8-10-12(13-3)14-4/h12H,2,5-10H2,1,3-4H3 |
| InChIKey | IIHCBEZXUXFCHJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|