C26H54O4 — CID 151305042
1,1,21,21-tetramethoxy-11-methylhenicosane (PubChem CID 151305042) has the molecular formula C26H54O4 and a molecular weight of 430.71 g/mol. Its IUPAC name is 1,1,21,21-tetramethoxy-11-methylhenicosane.
| Compound Name | 1,1,21,21-tetramethoxy-11-methylhenicosane |
|---|---|
| PubChem CID | 151305042 |
| Molecular Formula | C26H54O4 |
| Molecular Weight | 430.71 g/mol |
| Exact Mass | 430.40 |
| IUPAC Name | 1,1,21,21-tetramethoxy-11-methylhenicosane |
| SMILES | COC(CCCCCCCCCC(C)CCCCCCCCCC(OC)OC)OC |
| InChI | InChI=1S/C26H54O4/c1-24(20-16-12-8-6-10-14-18-22-25(27-2)28-3)21-17-13-9-7-11-15-19-23-26(29-4)30-5/h24-26H,6-23H2,1-5H3 |
| InChIKey | ODFIJUDSKSRRSW-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.71 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|