About CID 57182943
CID 57182943 (PubChem CID 57182943) has the molecular formula C5H11O2Si
and a molecular weight of 131.23 g/mol.
Molecular Properties
| Compound Name | CID 57182943 |
| PubChem CID | 57182943 |
| Molecular Formula | C5H11O2Si |
| Molecular Weight | 131.23 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | — |
| SMILES | COC(CC[Si])OC |
| InChI | InChI=1S/C5H11O2Si/c1-6-5(7-2)3-4-8/h5H,3-4H2,1-2H3 |
| InChIKey | RGAAORGTPXLLLT-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.23 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 57182943 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57182943?
The IUPAC name of CID 57182943 (CID 57182943) is not available.
What is the SMILES notation for CID 57182943?
The canonical SMILES for CID 57182943 is COC(CC[Si])OC.
What is the InChIKey of CID 57182943?
The InChIKey is RGAAORGTPXLLLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11O2Si/c1-6-5(7-2)3-4-8/h5H,3-4H2,1-2H3.
What are the key properties of CID 57182943?
CID 57182943 has a molecular weight of 131.23 g/mol, XLogP of 0.58, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57182943 is sourced from PubChem (CID 57182943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).