C9H22N2O2 — CID 11229262
(2S,4R)-7,7-dimethoxyheptane-2,4-diamine (PubChem CID 11229262) has the molecular formula C9H22N2O2 and a molecular weight of 190.29 g/mol. Its IUPAC name is (2S,4R)-7,7-dimethoxyheptane-2,4-diamine.
| Compound Name | (2S,4R)-7,7-dimethoxyheptane-2,4-diamine |
|---|---|
| PubChem CID | 11229262 |
| Molecular Formula | C9H22N2O2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | (2S,4R)-7,7-dimethoxyheptane-2,4-diamine |
| SMILES | COC(CC[C@@H](N)C[C@H](C)N)OC |
| InChI | InChI=1S/C9H22N2O2/c1-7(10)6-8(11)4-5-9(12-2)13-3/h7-9H,4-6,10-11H2,1-3H3/t7-,8+/m0/s1 |
| InChIKey | YBHANYHTMUFUMO-JGVFFNPUSA-N |
| XLogP | 0.45 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|