C7H16O4 — CID 57301339
5,5-dimethoxypentane-1,3-diol (PubChem CID 57301339) has the molecular formula C7H16O4 and a molecular weight of 164.20 g/mol. Its IUPAC name is 5,5-dimethoxypentane-1,3-diol.
| Compound Name | 5,5-dimethoxypentane-1,3-diol |
|---|---|
| PubChem CID | 57301339 |
| Molecular Formula | C7H16O4 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | 5,5-dimethoxypentane-1,3-diol |
| SMILES | COC(CC(O)CCO)OC |
| InChI | InChI=1S/C7H16O4/c1-10-7(11-2)5-6(9)3-4-8/h6-9H,3-5H2,1-2H3 |
| InChIKey | BWVXLKHMTSJKBZ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|