About CID 59090951
CID 59090951 (PubChem CID 59090951) has the molecular formula C6H12O3
and a molecular weight of 132.16 g/mol.
Molecular Properties
| Compound Name | CID 59090951 |
| PubChem CID | 59090951 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | — |
| SMILES | [CH]C(O)CC(OC)OC |
| InChI | InChI=1S/C6H12O3/c1-5(7)4-6(8-2)9-3/h1,5-7H,4H2,2-3H3 |
| InChIKey | KVWWPRQYGDWSEE-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 59090951 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59090951?
The IUPAC name of CID 59090951 (CID 59090951) is not available.
What is the SMILES notation for CID 59090951?
The canonical SMILES for CID 59090951 is [CH]C(O)CC(OC)OC.
What is the InChIKey of CID 59090951?
The InChIKey is KVWWPRQYGDWSEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3/c1-5(7)4-6(8-2)9-3/h1,5-7H,4H2,2-3H3.
What are the key properties of CID 59090951?
CID 59090951 has a molecular weight of 132.16 g/mol, XLogP of 0.07, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59090951 is sourced from PubChem (CID 59090951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).